C16H11F3N4O3S — CID 25138004
2-(carbamoylamino)-5-[2-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethynyl]thiophene-3-carboxamide (PubChem CID 25138004) has the molecular formula C16H11F3N4O3S and a molecular weight of 396.35 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[2-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethynyl]thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[2-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethynyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 25138004 |
| Molecular Formula | C16H11F3N4O3S |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-(carbamoylamino)-5-[2-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethynyl]thiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(C#Cc2cccc(NC(=O)C(F)(F)F)c2)cc1C(N)=O |
| InChI | InChI=1S/C16H11F3N4O3S/c17-16(18,19)14(25)22-9-3-1-2-8(6-9)4-5-10-7-11(12(20)24)13(27-10)23-15(21)26/h1-3,6-7H,(H2,20,24)(H,22,25)(H3,21,23,26) |
| InChIKey | HNNQEIJIRUIVKB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|