C16H13F2N5O2S — CID 25138034
3-[[4-(2,4-difluoroanilino)pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 25138034) has the molecular formula C16H13F2N5O2S and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-[[4-(2,4-difluoroanilino)pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-(2,4-difluoroanilino)pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 25138034 |
| Molecular Formula | C16H13F2N5O2S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-[[4-(2,4-difluoroanilino)pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2nccc(Nc3ccc(F)cc3F)n2)c1 |
| InChI | InChI=1S/C16H13F2N5O2S/c17-10-4-5-14(13(18)8-10)22-15-6-7-20-16(23-15)21-11-2-1-3-12(9-11)26(19,24)25/h1-9H,(H2,19,24,25)(H2,20,21,22,23) |
| InChIKey | JYOWTZHCFGOHFU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |