About 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide
3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide (PubChem CID 25138048) has the molecular formula C20H19N7O
and a molecular weight of 373.42 g/mol. Its IUPAC name is 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide.
Molecular Properties
| Compound Name | 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide |
| PubChem CID | 25138048 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide |
| SMILES | Cc1ccc2c(cnn2C)c1Nc1ccnc(Nc2cccc(C(N)=O)c2)n1 |
| InChI | InChI=1S/C20H19N7O/c1-12-6-7-16-15(11-23-27(16)2)18(12)25-17-8-9-22-20(26-17)24-14-5-3-4-13(10-14)19(21)28/h3-11H,1-2H3,(H2,21,28)(H2,22,24,25,26) |
| InChIKey | ZLWQZVBUIQXGBB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide?
The IUPAC name of 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide (CID 25138048) is 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide.
What is the SMILES notation for 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide?
The canonical SMILES for 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide is Cc1ccc2c(cnn2C)c1Nc1ccnc(Nc2cccc(C(N)=O)c2)n1.
What is the InChIKey of 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide?
The InChIKey is ZLWQZVBUIQXGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N7O/c1-12-6-7-16-15(11-23-27(16)2)18(12)25-17-8-9-22-20(26-17)24-14-5-3-4-13(10-14)19(21)28/h3-11H,1-2H3,(H2,21,28)(H2,22,24,25,26).
What are the key properties of 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide?
3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide has a molecular weight of 373.42 g/mol, XLogP of 3.26, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[(1,5-dimethylindazol-4-yl)amino]pyrimidin-2-yl]amino]benzamide is sourced from PubChem (CID 25138048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).