About N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine
N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine (PubChem CID 25138051) has the molecular formula C22H23N7
and a molecular weight of 385.48 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine |
| PubChem CID | 25138051 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4[nH]nc(-c5ccccc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C22H23N7/c1-28-11-13-29(14-12-28)18-9-7-17(8-10-18)24-22-23-15-19-21(25-22)20(27-26-19)16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | HPOZHFRJHZDSHY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine?
The IUPAC name of N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine (CID 25138051) is N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine.
What is the SMILES notation for N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine?
The canonical SMILES for N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine is CN1CCN(c2ccc(Nc3ncc4[nH]nc(-c5ccccc5)c4n3)cc2)CC1.
What is the InChIKey of N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine?
The InChIKey is HPOZHFRJHZDSHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N7/c1-28-11-13-29(14-12-28)18-9-7-17(8-10-18)24-22-23-15-19-21(25-22)20(27-26-19)16-5-3-2-4-6-16/h2-10,15H,11-14H2,1H3,(H,26,27)(H,23,24,25).
What are the key properties of N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine?
N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine has a molecular weight of 385.48 g/mol, XLogP of 3.52, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenyl-1H-pyrazolo[4,3-d]pyrimidin-5-amine is sourced from PubChem (CID 25138051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).