About 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide
4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 25138098) has the molecular formula C22H17F3N4OS
and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
Molecular Properties
| Compound Name | 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| PubChem CID | 25138098 |
| Molecular Formula | C22H17F3N4OS |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(CCNc2ncnc3ccsc23)cc1 |
| InChI | InChI=1S/C22H17F3N4OS/c23-22(24,25)16-2-1-3-17(12-16)29-21(30)15-6-4-14(5-7-15)8-10-26-20-19-18(9-11-31-19)27-13-28-20/h1-7,9,11-13H,8,10H2,(H,29,30)(H,26,27,28) |
| InChIKey | JMCRLXRZTYCGFU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide?
The IUPAC name of 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide (CID 25138098) is 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
What is the SMILES notation for 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide?
The canonical SMILES for 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide is O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(CCNc2ncnc3ccsc23)cc1.
What is the InChIKey of 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide?
The InChIKey is JMCRLXRZTYCGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3N4OS/c23-22(24,25)16-2-1-3-17(12-16)29-21(30)15-6-4-14(5-7-15)8-10-26-20-19-18(9-11-31-19)27-13-28-20/h1-7,9,11-13H,8,10H2,(H,29,30)(H,26,27,28).
What are the key properties of 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide?
4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide has a molecular weight of 442.47 g/mol, XLogP of 5.62, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-N-[3-(trifluoromethyl)phenyl]benzamide is sourced from PubChem (CID 25138098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).