C20H16N6OS2 — CID 25138111
1-(3-ethynylphenyl)-3-[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]urea (PubChem CID 25138111) has the molecular formula C20H16N6OS2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-(3-ethynylphenyl)-3-[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(3-ethynylphenyl)-3-[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 25138111 |
| Molecular Formula | C20H16N6OS2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-(3-ethynylphenyl)-3-[5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl]urea |
| SMILES | C#Cc1cccc(NC(=O)Nc2ncc(CCNc3ncnc4ccsc34)s2)c1 |
| InChI | InChI=1S/C20H16N6OS2/c1-2-13-4-3-5-14(10-13)25-19(27)26-20-22-11-15(29-20)6-8-21-18-17-16(7-9-28-17)23-12-24-18/h1,3-5,7,9-12H,6,8H2,(H,21,23,24)(H2,22,25,26,27) |
| InChIKey | AFEGNUNKORHENU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|