C24H27N3O4 — CID 25138261
(3R,4R)-4-[[4-[(2-ethyl-1H-indol-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide (PubChem CID 25138261) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (3R,4R)-4-[[4-[(2-ethyl-1H-indol-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide.
| Compound Name | (3R,4R)-4-[[4-[(2-ethyl-1H-indol-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide |
|---|---|
| PubChem CID | 25138261 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (3R,4R)-4-[[4-[(2-ethyl-1H-indol-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide |
| SMILES | CCc1[nH]c2ccccc2c1Cc1ccc(C(=O)N[C@@H]2CCOC[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-2-20-18(17-5-3-4-6-21(17)25-20)13-15-7-9-16(10-8-15)23(28)26-22-11-12-31-14-19(22)24(29)27-30/h3-10,19,22,25,30H,2,11-14H2,1H3,(H,26,28)(H,27,29)/t19-,22+/m0/s1 |
| InChIKey | VCNCKDLZUXUYIX-SIKLNZKXSA-N |
| XLogP | 2.96 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|