C25H30N4O4 — CID 25138272
(3R,4R)-4-[[4-[(2-tert-butylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide (PubChem CID 25138272) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is (3R,4R)-4-[[4-[(2-tert-butylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide.
| Compound Name | (3R,4R)-4-[[4-[(2-tert-butylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide |
|---|---|
| PubChem CID | 25138272 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (3R,4R)-4-[[4-[(2-tert-butylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzoyl]amino]-N-hydroxyoxane-3-carboxamide |
| SMILES | CC(C)(C)c1nn2ccccc2c1Cc1ccc(C(=O)N[C@@H]2CCOC[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-25(2,3)22-18(21-6-4-5-12-29(21)27-22)14-16-7-9-17(10-8-16)23(30)26-20-11-13-33-15-19(20)24(31)28-32/h4-10,12,19-20,32H,11,13-15H2,1-3H3,(H,26,30)(H,28,31)/t19-,20+/m0/s1 |
| InChIKey | KCBXQUWPZNVZIG-VQTJNVASSA-N |
| XLogP | 2.86 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|