C19H16Cl3F3N2O3 — CID 25138356
4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one (PubChem CID 25138356) has the molecular formula C19H16Cl3F3N2O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
|---|---|
| PubChem CID | 25138356 |
| Molecular Formula | C19H16Cl3F3N2O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
| SMILES | O=C(CCCc1ncc(C(F)(F)F)cc1Cl)N1CCc2c(Cl)c(O)c(O)c(Cl)c2C1 |
| InChI | InChI=1S/C19H16Cl3F3N2O3/c20-12-6-9(19(23,24)25)7-26-13(12)2-1-3-14(28)27-5-4-10-11(8-27)16(22)18(30)17(29)15(10)21/h6-7,29-30H,1-5,8H2 |
| InChIKey | JNMUCKVGXHVNOV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|