C34H49NO5Si — CID 25138406
tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 25138406) has the molecular formula C34H49NO5Si and a molecular weight of 579.85 g/mol. Its IUPAC name is tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 25138406 |
| Molecular Formula | C34H49NO5Si |
| Molecular Weight | 579.85 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | tert-butyl (2S,3S,4aR,5S,8aS)-3-[tert-butyl(diphenyl)silyl]oxy-5-(2-methoxy-2-oxoethyl)-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)C[C@@H]1CCC[C@H]2[C@@H]1C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H49NO5Si/c1-24-30(40-41(34(5,6)7,26-17-11-9-12-18-26)27-19-13-10-14-20-27)23-28-25(22-31(36)38-8)16-15-21-29(28)35(24)32(37)39-33(2,3)4/h9-14,17-20,24-25,28-30H,15-16,21-23H2,1-8H3/t24-,25-,28+,29-,30-/m0/s1 |
| InChIKey | APMBMIBNRQUZLE-LVDAESDLSA-N |
| XLogP | 6.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.85 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|