About [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate
[2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate (PubChem CID 25138681) has the molecular formula C14H11ClFN5O4
and a molecular weight of 367.72 g/mol. Its IUPAC name is [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate.
Molecular Properties
| Compound Name | [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate |
| PubChem CID | 25138681 |
| Molecular Formula | C14H11ClFN5O4 |
| Molecular Weight | 367.72 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(-n2nnc3c(cnn3C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C14H11ClFN5O4/c1-3-24-14(23)25-11-5-10(9(16)4-8(11)15)21-13(22)7-6-17-20(2)12(7)18-19-21/h4-6H,3H2,1-2H3 |
| InChIKey | PLOSMAPGOFAPQQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.72 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate?
The IUPAC name of [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate (CID 25138681) is [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate.
What is the SMILES notation for [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate?
The canonical SMILES for [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate is CCOC(=O)Oc1cc(-n2nnc3c(cnn3C)c2=O)c(F)cc1Cl.
What is the InChIKey of [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate?
The InChIKey is PLOSMAPGOFAPQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClFN5O4/c1-3-24-14(23)25-11-5-10(9(16)4-8(11)15)21-13(22)7-6-17-20(2)12(7)18-19-21/h4-6H,3H2,1-2H3.
What are the key properties of [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate?
[2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate has a molecular weight of 367.72 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-fluoro-5-(7-methyl-4-oxopyrazolo[5,4-d]triazin-3-yl)phenyl] ethyl carbonate is sourced from PubChem (CID 25138681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).