C21H21Cl3N4O3 — CID 25138874
2-[6,8-dichloro-2-(4-chloro-3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide (PubChem CID 25138874) has the molecular formula C21H21Cl3N4O3 and a molecular weight of 483.78 g/mol. Its IUPAC name is 2-[6,8-dichloro-2-(4-chloro-3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide.
| Compound Name | 2-[6,8-dichloro-2-(4-chloro-3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 25138874 |
| Molecular Formula | C21H21Cl3N4O3 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 2-[6,8-dichloro-2-(4-chloro-3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cc1c(-c2ccc(Cl)c([N+](=O)[O-])c2)nc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C21H21Cl3N4O3/c1-3-7-26(8-4-2)19(29)11-18-20(13-5-6-15(23)17(9-13)28(30)31)25-21-16(24)10-14(22)12-27(18)21/h5-6,9-10,12H,3-4,7-8,11H2,1-2H3 |
| InChIKey | OBTFDJHQRGAUKQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|