C21H23Cl3N4O — CID 25138879
2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide (PubChem CID 25138879) has the molecular formula C21H23Cl3N4O and a molecular weight of 453.80 g/mol. Its IUPAC name is 2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide.
| Compound Name | 2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 25138879 |
| Molecular Formula | C21H23Cl3N4O |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cc1c(-c2ccc(Cl)c(N)c2)nc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C21H23Cl3N4O/c1-3-7-27(8-4-2)19(29)11-18-20(13-5-6-15(23)17(25)9-13)26-21-16(24)10-14(22)12-28(18)21/h5-6,9-10,12H,3-4,7-8,11,25H2,1-2H3 |
| InChIKey | OEJBGIXBKZZTIO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|