C12H14F3N3O7 — CID 25138919
(2,5-dioxopyrrolidin-1-yl) (2S)-4-[methoxy(methyl)amino]-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 25138919) has the molecular formula C12H14F3N3O7 and a molecular weight of 369.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-4-[methoxy(methyl)amino]-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-4-[methoxy(methyl)amino]-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 25138919 |
| Molecular Formula | C12H14F3N3O7 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-4-[methoxy(methyl)amino]-4-oxo-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | CON(C)C(=O)C[C@H](NC(=O)C(F)(F)F)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H14F3N3O7/c1-17(24-2)9(21)5-6(16-11(23)12(13,14)15)10(22)25-18-7(19)3-4-8(18)20/h6H,3-5H2,1-2H3,(H,16,23)/t6-/m0/s1 |
| InChIKey | BDVWQFIUIVIFEL-LURJTMIESA-N |
| XLogP | -0.95 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|