C21H28N2O2 — CID 25139429
tert-butyl 3-(5-ethyl-1-methyl-3,6-dihydro-2H-pyridin-2-yl)indole-1-carboxylate (PubChem CID 25139429) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is tert-butyl 3-(5-ethyl-1-methyl-3,6-dihydro-2H-pyridin-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(5-ethyl-1-methyl-3,6-dihydro-2H-pyridin-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 25139429 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl 3-(5-ethyl-1-methyl-3,6-dihydro-2H-pyridin-2-yl)indole-1-carboxylate |
| SMILES | CCC1=CCC(c2cn(C(=O)OC(C)(C)C)c3ccccc23)N(C)C1 |
| InChI | InChI=1S/C21H28N2O2/c1-6-15-11-12-18(22(5)13-15)17-14-23(20(24)25-21(2,3)4)19-10-8-7-9-16(17)19/h7-11,14,18H,6,12-13H2,1-5H3 |
| InChIKey | SDCMMBLEHKOSRQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|