C26H36N2O — CID 25139481
N-[4-[cyclohexyl(propyl)amino]butyl]-4-phenylbenzamide (PubChem CID 25139481) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[4-[cyclohexyl(propyl)amino]butyl]-4-phenylbenzamide.
| Compound Name | N-[4-[cyclohexyl(propyl)amino]butyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 25139481 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N-[4-[cyclohexyl(propyl)amino]butyl]-4-phenylbenzamide |
| SMILES | CCCN(CCCCNC(=O)c1ccc(-c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C26H36N2O/c1-2-20-28(25-13-7-4-8-14-25)21-10-9-19-27-26(29)24-17-15-23(16-18-24)22-11-5-3-6-12-22/h3,5-6,11-12,15-18,25H,2,4,7-10,13-14,19-21H2,1H3,(H,27,29) |
| InChIKey | DPLNSFBAHKTNGS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|