About N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide
N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide (PubChem CID 25139764) has the molecular formula C22H26N4O
and a molecular weight of 362.48 g/mol. Its IUPAC name is N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide.
Molecular Properties
| Compound Name | N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide |
| PubChem CID | 25139764 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1cccc(-c2cc3ccc(/C(N)=N/C(C)C)cc3o2)c1 |
| InChI | InChI=1S/C22H26N4O/c1-13(2)25-21(23)17-7-5-6-15(10-17)19-11-16-8-9-18(12-20(16)27-19)22(24)26-14(3)4/h5-14H,1-4H3,(H2,23,25)(H2,24,26) |
| InChIKey | BPUITGRKJWSRQV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide?
The IUPAC name of N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide (CID 25139764) is N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide.
What is the SMILES notation for N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide?
The canonical SMILES for N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide is CC(C)/N=C(\N)c1cccc(-c2cc3ccc(/C(N)=N/C(C)C)cc3o2)c1.
What is the InChIKey of N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide?
The InChIKey is BPUITGRKJWSRQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O/c1-13(2)25-21(23)17-7-5-6-15(10-17)19-11-16-8-9-18(12-20(16)27-19)22(24)26-14(3)4/h5-14H,1-4H3,(H2,23,25)(H2,24,26).
What are the key properties of N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide?
N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide has a molecular weight of 362.48 g/mol, XLogP of 4.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-propan-2-yl-2-[3-(N'-propan-2-ylcarbamimidoyl)phenyl]-1-benzofuran-6-carboximidamide is sourced from PubChem (CID 25139764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).