C14H19N5O2 — CID 25139886
N',N'-dimethyl-N-(1-oxido-9,10-dihydro-8H-pyrano[2,3-h][1,2,4]benzotriazin-1-ium-3-yl)ethane-1,2-diamine (PubChem CID 25139886) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is N',N'-dimethyl-N-(1-oxido-9,10-dihydro-8H-pyrano[2,3-h][1,2,4]benzotriazin-1-ium-3-yl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(1-oxido-9,10-dihydro-8H-pyrano[2,3-h][1,2,4]benzotriazin-1-ium-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 25139886 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N',N'-dimethyl-N-(1-oxido-9,10-dihydro-8H-pyrano[2,3-h][1,2,4]benzotriazin-1-ium-3-yl)ethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc2ccc3c(c2[n+]([O-])n1)CCCO3 |
| InChI | InChI=1S/C14H19N5O2/c1-18(2)8-7-15-14-16-11-5-6-12-10(4-3-9-21-12)13(11)19(20)17-14/h5-6H,3-4,7-9H2,1-2H3,(H,15,16,17) |
| InChIKey | AQJXYJRNCYKLJV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|