About 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine]
4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] (PubChem CID 25139902) has the molecular formula C21H24BrNO2
and a molecular weight of 402.33 g/mol. Its IUPAC name is 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine].
Molecular Properties
| Compound Name | 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] |
| PubChem CID | 25139902 |
| Molecular Formula | C21H24BrNO2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] |
| SMILES | CC1(C)CC2(CN(Cc3ccccc3)CCO2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C21H24BrNO2/c1-20(2)14-21(18-12-17(22)8-9-19(18)25-20)15-23(10-11-24-21)13-16-6-4-3-5-7-16/h3-9,12H,10-11,13-15H2,1-2H3 |
| InChIKey | UDQTWLZXSSQPTB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine]?
The IUPAC name of 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] (CID 25139902) is 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine].
What is the SMILES notation for 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine]?
The canonical SMILES for 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] is CC1(C)CC2(CN(Cc3ccccc3)CCO2)c2cc(Br)ccc2O1.
What is the InChIKey of 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine]?
The InChIKey is UDQTWLZXSSQPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BrNO2/c1-20(2)14-21(18-12-17(22)8-9-19(18)25-20)15-23(10-11-24-21)13-16-6-4-3-5-7-16/h3-9,12H,10-11,13-15H2,1-2H3.
What are the key properties of 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine]?
4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] has a molecular weight of 402.33 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-benzyl-6-bromo-2,2-dimethylspiro[3H-chromene-4,2'-morpholine] is sourced from PubChem (CID 25139902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).