C26H20O4 — CID 25140013
(1R,14S)-15,15-dimethyl-12,16-dioxahexacyclo[12.12.0.02,11.03,8.017,26.019,24]hexacosa-2(11),3,5,7,9,17(26),19,21,23-nonaene-18,25-dione (PubChem CID 25140013) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is (1R,14S)-15,15-dimethyl-12,16-dioxahexacyclo[12.12.0.02,11.03,8.017,26.019,24]hexacosa-2(11),3,5,7,9,17(26),19,21,23-nonaene-18,25-dione.
| Compound Name | (1R,14S)-15,15-dimethyl-12,16-dioxahexacyclo[12.12.0.02,11.03,8.017,26.019,24]hexacosa-2(11),3,5,7,9,17(26),19,21,23-nonaene-18,25-dione |
|---|---|
| PubChem CID | 25140013 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (1R,14S)-15,15-dimethyl-12,16-dioxahexacyclo[12.12.0.02,11.03,8.017,26.019,24]hexacosa-2(11),3,5,7,9,17(26),19,21,23-nonaene-18,25-dione |
| SMILES | CC1(C)OC2=C(C(=O)c3ccccc3C2=O)[C@H]2c3c(ccc4ccccc34)OC[C@H]21 |
| InChI | InChI=1S/C26H20O4/c1-26(2)18-13-29-19-12-11-14-7-3-4-8-15(14)20(19)21(18)22-23(27)16-9-5-6-10-17(16)24(28)25(22)30-26/h3-12,18,21H,13H2,1-2H3/t18-,21-/m1/s1 |
| InChIKey | VFYWRYGVBYHWMB-WIYYLYMNSA-N |
| XLogP | 5.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|