C24H29NO5 — CID 25140469
(E)-but-2-enedioic acid;(3-pentoxy-9,10-dihydroanthracen-9-yl)methanamine (PubChem CID 25140469) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3-pentoxy-9,10-dihydroanthracen-9-yl)methanamine.
| Compound Name | (E)-but-2-enedioic acid;(3-pentoxy-9,10-dihydroanthracen-9-yl)methanamine |
|---|---|
| PubChem CID | 25140469 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (E)-but-2-enedioic acid;(3-pentoxy-9,10-dihydroanthracen-9-yl)methanamine |
| SMILES | CCCCCOc1ccc2c(c1)Cc1ccccc1C2CN.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H25NO.C4H4O4/c1-2-3-6-11-22-17-9-10-19-16(13-17)12-15-7-4-5-8-18(15)20(19)14-21;5-3(6)1-2-4(7)8/h4-5,7-10,13,20H,2-3,6,11-12,14,21H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | DDSNHNBLVJEQLJ-WLHGVMLRSA-N |
| XLogP | 3.96 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|