C21H22Cl2N4O3 — CID 25140479
2-[6,8-dichloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide (PubChem CID 25140479) has the molecular formula C21H22Cl2N4O3 and a molecular weight of 449.34 g/mol. Its IUPAC name is 2-[6,8-dichloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide.
| Compound Name | 2-[6,8-dichloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 25140479 |
| Molecular Formula | C21H22Cl2N4O3 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[6,8-dichloro-2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cc1c(-c2ccc([N+](=O)[O-])cc2)nc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C21H22Cl2N4O3/c1-3-9-25(10-4-2)19(28)12-18-20(14-5-7-16(8-6-14)27(29)30)24-21-17(23)11-15(22)13-26(18)21/h5-8,11,13H,3-4,9-10,12H2,1-2H3 |
| InChIKey | HFLZKYYKRXMNPI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|