C20H21Cl3N4O — CID 25140481
2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N-butyl-N-methylacetamide (PubChem CID 25140481) has the molecular formula C20H21Cl3N4O and a molecular weight of 439.77 g/mol. Its IUPAC name is 2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N-butyl-N-methylacetamide.
| Compound Name | 2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N-butyl-N-methylacetamide |
|---|---|
| PubChem CID | 25140481 |
| Molecular Formula | C20H21Cl3N4O |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[2-(3-amino-4-chlorophenyl)-6,8-dichloroimidazo[1,2-a]pyridin-3-yl]-N-butyl-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)Cc1c(-c2ccc(Cl)c(N)c2)nc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C20H21Cl3N4O/c1-3-4-7-26(2)18(28)10-17-19(12-5-6-14(22)16(24)8-12)25-20-15(23)9-13(21)11-27(17)20/h5-6,8-9,11H,3-4,7,10,24H2,1-2H3 |
| InChIKey | DFGUYFLOROSCRR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|