C27H32N2O7S — CID 25140739
2-[(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 25140739) has the molecular formula C27H32N2O7S and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-[(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 5-(dimethylamino)naphthalene-1-sulfonate.
| Compound Name | 2-[(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 5-(dimethylamino)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 25140739 |
| Molecular Formula | C27H32N2O7S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 2-[(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)OCC[C@H]3C(=O)N[C@@]4([C@@H](O)[C@@H]5C=CCCC5)C(=O)O[C@@]34C)cccc12 |
| InChI | InChI=1S/C27H32N2O7S/c1-26-20(24(31)28-27(26,25(32)36-26)23(30)17-9-5-4-6-10-17)15-16-35-37(33,34)22-14-8-11-18-19(22)12-7-13-21(18)29(2)3/h5,7-9,11-14,17,20,23,30H,4,6,10,15-16H2,1-3H3,(H,28,31)/t17-,20+,23+,26+,27+/m1/s1 |
| InChIKey | KHUBMJSUZYEULF-PDIKNTFRSA-N |
| XLogP | 2.52 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|