C24H32F3N5O3S — CID 25140849
(S)-N-[(1R)-1-[(1R,5S)-8-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 25140849) has the molecular formula C24H32F3N5O3S and a molecular weight of 527.61 g/mol. Its IUPAC name is (S)-N-[(1R)-1-[(1R,5S)-8-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-[(1R,5S)-8-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 25140849 |
| Molecular Formula | C24H32F3N5O3S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (S)-N-[(1R)-1-[(1R,5S)-8-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-azabicyclo[3.2.1]octan-3-yl]-2-(2,4,5-trifluorophenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1nc(OC)nc(N2[C@@H]3CC[C@H]2CC([C@@H](Cc2cc(F)c(F)cc2F)N[S@@](=O)C(C)(C)C)C3)n1 |
| InChI | InChI=1S/C24H32F3N5O3S/c1-24(2,3)36(33)31-20(11-13-10-18(26)19(27)12-17(13)25)14-8-15-6-7-16(9-14)32(15)21-28-22(34-4)30-23(29-21)35-5/h10,12,14-16,20,31H,6-9,11H2,1-5H3/t14?,15-,16+,20-,36+/m1/s1 |
| InChIKey | FLEVZFXYTIHOKT-AWLLHOMKSA-N |
| XLogP | 3.72 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|