C9H17NO3 — CID 25141059
N-[(Z,2R,3R)-1,3-dihydroxyhept-4-en-2-yl]acetamide (PubChem CID 25141059) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is N-[(Z,2R,3R)-1,3-dihydroxyhept-4-en-2-yl]acetamide.
| Compound Name | N-[(Z,2R,3R)-1,3-dihydroxyhept-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 25141059 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | N-[(Z,2R,3R)-1,3-dihydroxyhept-4-en-2-yl]acetamide |
| SMILES | CC/C=C\[C@@H](O)[C@@H](CO)NC(C)=O |
| InChI | InChI=1S/C9H17NO3/c1-3-4-5-9(13)8(6-11)10-7(2)12/h4-5,8-9,11,13H,3,6H2,1-2H3,(H,10,12)/b5-4-/t8-,9-/m1/s1 |
| InChIKey | OSQKYXSDUMJDCJ-UVSMVFJQSA-N |
| XLogP | -0.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|