C31H37ClO12 — CID 25141512
methyl 2-[4-[(2-chloroacetyl)oxy-(furan-3-yl)methyl]-15,16-dihydroxy-4,12,17,19-tetramethyl-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetate (PubChem CID 25141512) has the molecular formula C31H37ClO12 and a molecular weight of 637.08 g/mol. Its IUPAC name is methyl 2-[4-[(2-chloroacetyl)oxy-(furan-3-yl)methyl]-15,16-dihydroxy-4,12,17,19-tetramethyl-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetate.
| Compound Name | methyl 2-[4-[(2-chloroacetyl)oxy-(furan-3-yl)methyl]-15,16-dihydroxy-4,12,17,19-tetramethyl-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetate |
|---|---|
| PubChem CID | 25141512 |
| Molecular Formula | C31H37ClO12 |
| Molecular Weight | 637.08 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | methyl 2-[4-[(2-chloroacetyl)oxy-(furan-3-yl)methyl]-15,16-dihydroxy-4,12,17,19-tetramethyl-7-oxo-8,11,13,20-tetraoxaheptacyclo[10.7.1.114,17.01,10.05,10.09,15.014,19]henicosan-18-yl]acetate |
| SMILES | COC(=O)CC1C2(C)CC34OC5(C)OC67C(CC(=O)OC6C3(O)C2O)C(C)(C(OC(=O)CCl)c2ccoc2)CCC7(O5)C14C |
| InChI | InChI=1S/C31H37ClO12/c1-24(21(40-20(35)12-32)15-6-9-39-13-15)7-8-28-26(3)16(10-18(33)38-5)25(2)14-29(26)30(37,22(25)36)23-31(28,17(24)11-19(34)41-23)44-27(4,42-28)43-29/h6,9,13,16-17,21-23,36-37H,7-8,10-12,14H2,1-5H3 |
| InChIKey | HWQDMJPVWFGTLQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 160.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.08 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|