C20H31NO3 — CID 25141869
(2R)-heptan-2-amine;2-[(8R)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetic acid (PubChem CID 25141869) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (2R)-heptan-2-amine;2-[(8R)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetic acid.
| Compound Name | (2R)-heptan-2-amine;2-[(8R)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetic acid |
|---|---|
| PubChem CID | 25141869 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (2R)-heptan-2-amine;2-[(8R)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]acetic acid |
| SMILES | CCCCC[C@@H](C)N.O=C(O)C[C@H]1CCc2ccc3c(c21)CCO3 |
| InChI | InChI=1S/C13H14O3.C7H17N/c14-12(15)7-9-2-1-8-3-4-11-10(13(8)9)5-6-16-11;1-3-4-5-6-7(2)8/h3-4,9H,1-2,5-7H2,(H,14,15);7H,3-6,8H2,1-2H3/t9-;7-/m11/s1 |
| InChIKey | JBPYBQPWMOMQNN-XPNWLKPYSA-N |
| XLogP | 4.04 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|