C8H9N3S2 — CID 25143091
4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-dihydroimidazole-2-thione (PubChem CID 25143091) has the molecular formula C8H9N3S2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 25143091 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-dihydroimidazole-2-thione |
| SMILES | Cc1nc(C)c(-c2c[nH]c(=S)[nH]2)s1 |
| InChI | InChI=1S/C8H9N3S2/c1-4-7(13-5(2)10-4)6-3-9-8(12)11-6/h3H,1-2H3,(H2,9,11,12) |
| InChIKey | IQLAXIPPNQPWJP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|