C11H14N2S2 — CID 25143097
4-[5-(2-methylpropyl)thiophen-2-yl]-1,3-dihydroimidazole-2-thione (PubChem CID 25143097) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 4-[5-(2-methylpropyl)thiophen-2-yl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[5-(2-methylpropyl)thiophen-2-yl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 25143097 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-[5-(2-methylpropyl)thiophen-2-yl]-1,3-dihydroimidazole-2-thione |
| SMILES | CC(C)Cc1ccc(-c2c[nH]c(=S)[nH]2)s1 |
| InChI | InChI=1S/C11H14N2S2/c1-7(2)5-8-3-4-10(15-8)9-6-12-11(14)13-9/h3-4,6-7H,5H2,1-2H3,(H2,12,13,14) |
| InChIKey | HDDFKUSTJQLNAP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|