C24H23N5O3 — CID 25144090
[2-amino-5-[3-(2-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 25144090) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is [2-amino-5-[3-(2-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2-amino-5-[3-(2-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 25144090 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [2-amino-5-[3-(2-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-5-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | COc1ccccc1-c1[nH]nc2ncc(-c3ccc(N)c(C(=O)N4CCOCC4)c3)cc12 |
| InChI | InChI=1S/C24H23N5O3/c1-31-21-5-3-2-4-17(21)22-19-13-16(14-26-23(19)28-27-22)15-6-7-20(25)18(12-15)24(30)29-8-10-32-11-9-29/h2-7,12-14H,8-11,25H2,1H3,(H,26,27,28) |
| InChIKey | SSKBEXDNRVQWHS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|