C28H23NO3 — CID 25144613
3-(3-naphthalen-1-yloxypropyl)-7-phenyl-1H-indole-2-carboxylic acid (PubChem CID 25144613) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-(3-naphthalen-1-yloxypropyl)-7-phenyl-1H-indole-2-carboxylic acid.
| Compound Name | 3-(3-naphthalen-1-yloxypropyl)-7-phenyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25144613 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-(3-naphthalen-1-yloxypropyl)-7-phenyl-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(-c3ccccc3)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C28H23NO3/c30-28(31)27-24(16-8-18-32-25-17-6-12-19-11-4-5-13-21(19)25)23-15-7-14-22(26(23)29-27)20-9-2-1-3-10-20/h1-7,9-15,17,29H,8,16,18H2,(H,30,31) |
| InChIKey | KTRRVUAMYYAKSN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|