About (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid
(E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid (PubChem CID 25144684) has the molecular formula C7H6F6O2
and a molecular weight of 236.11 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid.
Molecular Properties
| Compound Name | (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid |
| PubChem CID | 25144684 |
| Molecular Formula | C7H6F6O2 |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid |
| SMILES | C/C(=C\C(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H6F6O2/c1-3(5(14)15)2-4(6(8,9)10)7(11,12)13/h2,4H,1H3,(H,14,15)/b3-2+ |
| InChIKey | HHPAOJUQDMPRFO-NSCUHMNNSA-N |
| XLogP | 2.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid?
The IUPAC name of (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid (CID 25144684) is (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid.
What is the SMILES notation for (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid?
The canonical SMILES for (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid is C/C(=C\C(C(F)(F)F)C(F)(F)F)C(=O)O.
What is the InChIKey of (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid?
The InChIKey is HHPAOJUQDMPRFO-NSCUHMNNSA-N. The full InChI is InChI=1S/C7H6F6O2/c1-3(5(14)15)2-4(6(8,9)10)7(11,12)13/h2,4H,1H3,(H,14,15)/b3-2+.
What are the key properties of (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid?
(E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid has a molecular weight of 236.11 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5,5-trifluoro-2-methyl-4-(trifluoromethyl)pent-2-enoic acid is sourced from PubChem (CID 25144684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).