C20H21ClO4 — CID 25144719
1,1,1-trideuteriopropan-2-yl 2-[4-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-2,3,5,6-tetradeuteriophenoxy]-3,3,3-trideuterio-2-methylpropanoate (PubChem CID 25144719) has the molecular formula C20H21ClO4 and a molecular weight of 374.92 g/mol. Its IUPAC name is 1,1,1-trideuteriopropan-2-yl 2-[4-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-2,3,5,6-tetradeuteriophenoxy]-3,3,3-trideuterio-2-methylpropanoate.
| Compound Name | 1,1,1-trideuteriopropan-2-yl 2-[4-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-2,3,5,6-tetradeuteriophenoxy]-3,3,3-trideuterio-2-methylpropanoate |
|---|---|
| PubChem CID | 25144719 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1,1,1-trideuteriopropan-2-yl 2-[4-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-2,3,5,6-tetradeuteriophenoxy]-3,3,3-trideuterio-2-methylpropanoate |
| SMILES | [2H]c1c([2H])c(C(=O)c2c([2H])c([2H])c(OC(C)(C(=O)OC(C)C([2H])([2H])[2H])C([2H])([2H])[2H])c([2H])c2[2H])c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C20H21ClO4/c1-13(2)24-19(23)20(3,4)25-17-11-7-15(8-12-17)18(22)14-5-9-16(21)10-6-14/h5-13H,1-4H3/i1D3,3D3,5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | YMTINGFKWWXKFG-GIIWSHSGSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |