C8H18O21P6 — CID 25144826
[4,6,13,15-tetrahydroxy-10-[hydroxy(methoxy)phosphoryl]oxy-4,6,13,15-tetraoxo-3,5,7,12,14,16-hexaoxa-4λ5,6λ5,13λ5,15λ5-tetraphosphatricyclo[9.5.0.02,8]hexadecan-9-yl]methylphosphonic acid (PubChem CID 25144826) has the molecular formula C8H18O21P6 and a molecular weight of 636.06 g/mol. Its IUPAC name is [4,6,13,15-tetrahydroxy-10-[hydroxy(methoxy)phosphoryl]oxy-4,6,13,15-tetraoxo-3,5,7,12,14,16-hexaoxa-4λ5,6λ5,13λ5,15λ5-tetraphosphatricyclo[9.5.0.02,8]hexadecan-9-yl]methylphosphonic acid.
| Compound Name | [4,6,13,15-tetrahydroxy-10-[hydroxy(methoxy)phosphoryl]oxy-4,6,13,15-tetraoxo-3,5,7,12,14,16-hexaoxa-4λ5,6λ5,13λ5,15λ5-tetraphosphatricyclo[9.5.0.02,8]hexadecan-9-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 25144826 |
| Molecular Formula | C8H18O21P6 |
| Molecular Weight | 636.06 g/mol |
| Exact Mass | 635.88 |
| IUPAC Name | [4,6,13,15-tetrahydroxy-10-[hydroxy(methoxy)phosphoryl]oxy-4,6,13,15-tetraoxo-3,5,7,12,14,16-hexaoxa-4λ5,6λ5,13λ5,15λ5-tetraphosphatricyclo[9.5.0.02,8]hexadecan-9-yl]methylphosphonic acid |
| SMILES | COP(=O)(O)OC1C(CP(=O)(O)O)C2OP(=O)(O)OP(=O)(O)OC2C2OP(=O)(O)OP(=O)(O)OC12 |
| InChI | InChI=1S/C8H18O21P6/c1-22-31(12,13)23-4-3(2-30(9,10)11)5-7(26-33(16,17)28-32(14,15)24-5)8-6(4)25-34(18,19)29-35(20,21)27-8/h3-8H,2H2,1H3,(H,12,13)(H,14,15)(H,16,17)(H,18,19)(H,20,21)(H2,9,10,11) |
| InChIKey | QTNKWUPSPYBQFD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 317.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.06 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|