C24H21F2NO3 — CID 25145353
(3R,4S)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-3-[(3S)-1,1,2,2,3-pentadeuterio-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one (PubChem CID 25145353) has the molecular formula C24H21F2NO3 and a molecular weight of 414.46 g/mol. Its IUPAC name is (3R,4S)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-3-[(3S)-1,1,2,2,3-pentadeuterio-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one.
| Compound Name | (3R,4S)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-3-[(3S)-1,1,2,2,3-pentadeuterio-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one |
|---|---|
| PubChem CID | 25145353 |
| Molecular Formula | C24H21F2NO3 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (3R,4S)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-3-[(3S)-1,1,2,2,3-pentadeuterio-3-(4-fluorophenyl)-3-hydroxypropyl]azetidin-2-one |
| SMILES | [2H]C([2H])([C@H]1C(=O)N(c2ccc(F)cc2)[C@@H]1c1ccc(O)cc1)C([2H])([2H])[C@]([2H])(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1/i13D2,14D2,22D |
| InChIKey | OLNTVTPDXPETLC-MSQWCUHLSA-N |
| XLogP | 4.89 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |