C21H24FN3O4 — CID 25145555
1-cyclopropyl-7-(2,2,3,3,4,4,5,5,7,7-decadeuterio-4a,7a-dihydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 25145555) has the molecular formula C21H24FN3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-cyclopropyl-7-(2,2,3,3,4,4,5,5,7,7-decadeuterio-4a,7a-dihydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-(2,2,3,3,4,4,5,5,7,7-decadeuterio-4a,7a-dihydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 25145555 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-cyclopropyl-7-(2,2,3,3,4,4,5,5,7,7-decadeuterio-4a,7a-dihydro-1H-pyrrolo[3,4-b]pyridin-6-yl)-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | [2H]C1([2H])C2NC([2H])([2H])C([2H])([2H])C([2H])([2H])C2C([2H])([2H])N1c1c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c2c1OC |
| InChI | InChI=1S/C21H24FN3O4/c1-29-20-17-13(19(26)14(21(27)28)9-25(17)12-4-5-12)7-15(22)18(20)24-8-11-3-2-6-23-16(11)10-24/h7,9,11-12,16,23H,2-6,8,10H2,1H3,(H,27,28)/i2D2,3D2,6D2,8D2,10D2 |
| InChIKey | FABPRXSRWADJSP-UTFQPTJZSA-N |
| XLogP | 2.37 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |