C27H52O5Si — CID 25145878
(2S,3R,5R)-2-[(E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-3-enyl]-5-methyl-5-propyloxolan-3-ol (PubChem CID 25145878) has the molecular formula C27H52O5Si and a molecular weight of 484.79 g/mol. Its IUPAC name is (2S,3R,5R)-2-[(E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-3-enyl]-5-methyl-5-propyloxolan-3-ol.
| Compound Name | (2S,3R,5R)-2-[(E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-3-enyl]-5-methyl-5-propyloxolan-3-ol |
|---|---|
| PubChem CID | 25145878 |
| Molecular Formula | C27H52O5Si |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (2S,3R,5R)-2-[(E,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-7-(2-methyl-1,3-dioxolan-2-yl)hept-3-enyl]-5-methyl-5-propyloxolan-3-ol |
| SMILES | CCC[C@]1(C)C[C@@H](O)[C@H](CC/C(C)=C/[C@@H](C)[C@H](CC2(C)OCCO2)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H52O5Si/c1-11-14-26(7)18-22(28)23(31-26)13-12-20(2)17-21(3)24(19-27(8)29-15-16-30-27)32-33(9,10)25(4,5)6/h17,21-24,28H,11-16,18-19H2,1-10H3/b20-17+/t21-,22-,23+,24+,26-/m1/s1 |
| InChIKey | JYHRKLBVGXNMQG-QXKBOYHFSA-N |
| XLogP | 6.60 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|