About N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide
N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 25145900) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide.
Molecular Properties
| Compound Name | N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide |
| PubChem CID | 25145900 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | CCCCNC(=O)CC1CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C17H25NO3/c1-4-5-8-18-17(19)10-13-7-6-12-9-15(20-2)16(21-3)11-14(12)13/h9,11,13H,4-8,10H2,1-3H3,(H,18,19) |
| InChIKey | FZDXFLGHTUDSFW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide?
The IUPAC name of N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide (CID 25145900) is N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide.
What is the SMILES notation for N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide?
The canonical SMILES for N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide is CCCCNC(=O)CC1CCc2cc(OC)c(OC)cc21.
What is the InChIKey of N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide?
The InChIKey is FZDXFLGHTUDSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-4-5-8-18-17(19)10-13-7-6-12-9-15(20-2)16(21-3)11-14(12)13/h9,11,13H,4-8,10H2,1-3H3,(H,18,19).
What are the key properties of N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide?
N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide has a molecular weight of 291.39 g/mol, XLogP of 3.04, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)acetamide is sourced from PubChem (CID 25145900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).