C13H20N2O5 — CID 25145938
(1R,2R,5S,6S,8R)-6-(carboxymethyl)-7-oxa-4,13-diazatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid (PubChem CID 25145938) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is (1R,2R,5S,6S,8R)-6-(carboxymethyl)-7-oxa-4,13-diazatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid.
| Compound Name | (1R,2R,5S,6S,8R)-6-(carboxymethyl)-7-oxa-4,13-diazatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid |
|---|---|
| PubChem CID | 25145938 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (1R,2R,5S,6S,8R)-6-(carboxymethyl)-7-oxa-4,13-diazatricyclo[6.5.0.02,6]tridecane-5-carboxylic acid |
| SMILES | O=C(O)C[C@]12O[C@@H]3CCCCN[C@@H]3[C@H]1CN[C@@H]2C(=O)O |
| InChI | InChI=1S/C13H20N2O5/c16-9(17)5-13-7(6-15-11(13)12(18)19)10-8(20-13)3-1-2-4-14-10/h7-8,10-11,14-15H,1-6H2,(H,16,17)(H,18,19)/t7-,8-,10-,11-,13+/m1/s1 |
| InChIKey | GZVWAWSETWNPAP-NSOMGTDFSA-N |
| XLogP | -0.59 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |