About (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium
(Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium (PubChem CID 25146078) has the molecular formula C12H13N5O8
and a molecular weight of 355.26 g/mol. Its IUPAC name is (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium.
Molecular Properties
| Compound Name | (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium |
| PubChem CID | 25146078 |
| Molecular Formula | C12H13N5O8 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium |
| SMILES | COC(=O)[C@@H]1CCCN1/[N+]([O-])=N/Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O8/c1-24-12(18)9-3-2-6-14(9)17(23)13-25-11-5-4-8(15(19)20)7-10(11)16(21)22/h4-5,7,9H,2-3,6H2,1H3/b17-13-/t9-/m0/s1 |
| InChIKey | QWHCVJSPDUQBJM-KWSCKXNYSA-N |
| XLogP | 1.31 |
| TPSA | 163.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium?
The IUPAC name of (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium (CID 25146078) is (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium.
What is the SMILES notation for (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium?
The canonical SMILES for (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium is COC(=O)[C@@H]1CCCN1/[N+]([O-])=N/Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium?
The InChIKey is QWHCVJSPDUQBJM-KWSCKXNYSA-N. The full InChI is InChI=1S/C12H13N5O8/c1-24-12(18)9-3-2-6-14(9)17(23)13-25-11-5-4-8(15(19)20)7-10(11)16(21)22/h4-5,7,9H,2-3,6H2,1H3/b17-13-/t9-/m0/s1.
What are the key properties of (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium?
(Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium has a molecular weight of 355.26 g/mol, XLogP of 1.31, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-(2,4-dinitrophenoxy)imino-[(2S)-2-methoxycarbonylpyrrolidin-1-yl]-oxidoazanium is sourced from PubChem (CID 25146078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).