About [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate
[2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 25146309) has the molecular formula C20H16F3NO4
and a molecular weight of 391.35 g/mol. Its IUPAC name is [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate |
| PubChem CID | 25146309 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(C2CC(C(F)(F)F)=NO2)ccc1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H16F3NO4/c1-26-17-11-14(16-12-18(24-28-16)20(21,22)23)8-9-15(17)27-19(25)10-7-13-5-3-2-4-6-13/h2-11,16H,12H2,1H3/b10-7+ |
| InChIKey | VPRQJLQWUJRSGB-JXMROGBWSA-N |
| XLogP | 4.69 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate?
The IUPAC name of [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate (CID 25146309) is [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate.
What is the SMILES notation for [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate?
The canonical SMILES for [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate is COc1cc(C2CC(C(F)(F)F)=NO2)ccc1OC(=O)/C=C/c1ccccc1.
What is the InChIKey of [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate?
The InChIKey is VPRQJLQWUJRSGB-JXMROGBWSA-N. The full InChI is InChI=1S/C20H16F3NO4/c1-26-17-11-14(16-12-18(24-28-16)20(21,22)23)8-9-15(17)27-19(25)10-7-13-5-3-2-4-6-13/h2-11,16H,12H2,1H3/b10-7+.
What are the key properties of [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate?
[2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate has a molecular weight of 391.35 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4-[3-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-5-yl]phenyl] (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 25146309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).