C18H23NO6 — CID 25146439
20-methyl-2,5,11,14,17-pentaoxa-8-azatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one (PubChem CID 25146439) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 20-methyl-2,5,11,14,17-pentaoxa-8-azatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one.
| Compound Name | 20-methyl-2,5,11,14,17-pentaoxa-8-azatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one |
|---|---|
| PubChem CID | 25146439 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 20-methyl-2,5,11,14,17-pentaoxa-8-azatricyclo[13.8.0.016,21]tricosa-1(15),16(21),19,22-tetraen-18-one |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)OCCOCCNCCOCCO3 |
| InChI | InChI=1S/C18H23NO6/c1-13-12-16(20)25-17-14(13)2-3-15-18(17)24-11-9-22-7-5-19-4-6-21-8-10-23-15/h2-3,12,19H,4-11H2,1H3 |
| InChIKey | PBGPTMZMFRDOAV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|