C26H46O5Si2 — CID 25146470
[(3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxoheptyl] benzoate (PubChem CID 25146470) has the molecular formula C26H46O5Si2 and a molecular weight of 494.82 g/mol. Its IUPAC name is [(3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxoheptyl] benzoate.
| Compound Name | [(3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxoheptyl] benzoate |
|---|---|
| PubChem CID | 25146470 |
| Molecular Formula | C26H46O5Si2 |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [(3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxoheptyl] benzoate |
| SMILES | CCC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCOC(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O5Si2/c1-12-21(27)23(31-33(10,11)26(5,6)7)22(30-32(8,9)25(2,3)4)18-19-29-24(28)20-16-14-13-15-17-20/h13-17,22-23H,12,18-19H2,1-11H3/t22-,23-/m0/s1 |
| InChIKey | SSFOKTQRZOSRDB-GOTSBHOMSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|