C21H23N5S — CID 25146499
2-[3-[1-[4-(2-methylpropyl)phenyl]ethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline (PubChem CID 25146499) has the molecular formula C21H23N5S and a molecular weight of 377.52 g/mol. Its IUPAC name is 2-[3-[1-[4-(2-methylpropyl)phenyl]ethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline.
| Compound Name | 2-[3-[1-[4-(2-methylpropyl)phenyl]ethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline |
|---|---|
| PubChem CID | 25146499 |
| Molecular Formula | C21H23N5S |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[3-[1-[4-(2-methylpropyl)phenyl]ethyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]aniline |
| SMILES | CC(C)Cc1ccc(C(C)c2nnc3sc(-c4ccccc4N)nn23)cc1 |
| InChI | InChI=1S/C21H23N5S/c1-13(2)12-15-8-10-16(11-9-15)14(3)19-23-24-21-26(19)25-20(27-21)17-6-4-5-7-18(17)22/h4-11,13-14H,12,22H2,1-3H3 |
| InChIKey | LBNQNAYXECKZBD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|