C38H48O6Si — CID 25146569
(4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2S)-2-[(4-methoxyphenyl)methoxy]-3,3-dimethyl-4-oxohept-6-enyl]oxan-2-one (PubChem CID 25146569) has the molecular formula C38H48O6Si and a molecular weight of 628.88 g/mol. Its IUPAC name is (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2S)-2-[(4-methoxyphenyl)methoxy]-3,3-dimethyl-4-oxohept-6-enyl]oxan-2-one.
| Compound Name | (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2S)-2-[(4-methoxyphenyl)methoxy]-3,3-dimethyl-4-oxohept-6-enyl]oxan-2-one |
|---|---|
| PubChem CID | 25146569 |
| Molecular Formula | C38H48O6Si |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | (4R,6S)-4-[tert-butyl(diphenyl)silyl]oxy-6-[(2S)-2-[(4-methoxyphenyl)methoxy]-3,3-dimethyl-4-oxohept-6-enyl]oxan-2-one |
| SMILES | C=CCC(=O)C(C)(C)[C@H](C[C@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)O1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C38H48O6Si/c1-8-15-34(39)38(5,6)35(42-27-28-20-22-29(41-7)23-21-28)25-30-24-31(26-36(40)43-30)44-45(37(2,3)4,32-16-11-9-12-17-32)33-18-13-10-14-19-33/h8-14,16-23,30-31,35H,1,15,24-27H2,2-7H3/t30-,31-,35+/m1/s1 |
| InChIKey | ASUJDTZKNSMNIF-MCQSSSDPSA-N |
| XLogP | 6.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|