C33H20N4O2S3 — CID 25146647
(5E)-3-(6-benzoyl-3,4-diphenylthieno[2,3-c]pyridazin-5-yl)-2-imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 25146647) has the molecular formula C33H20N4O2S3 and a molecular weight of 600.75 g/mol. Its IUPAC name is (5E)-3-(6-benzoyl-3,4-diphenylthieno[2,3-c]pyridazin-5-yl)-2-imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(6-benzoyl-3,4-diphenylthieno[2,3-c]pyridazin-5-yl)-2-imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 25146647 |
| Molecular Formula | C33H20N4O2S3 |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | (5E)-3-(6-benzoyl-3,4-diphenylthieno[2,3-c]pyridazin-5-yl)-2-imino-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C/c2cccs2)C(=O)N1c1c(C(=O)c2ccccc2)sc2nnc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C33H20N4O2S3/c34-33-37(32(39)24(41-33)19-23-17-10-18-40-23)28-26-25(20-11-4-1-5-12-20)27(21-13-6-2-7-14-21)35-36-31(26)42-30(28)29(38)22-15-8-3-9-16-22/h1-19,34H/b24-19+,34-33- |
| InChIKey | AFFPCKSETLILJQ-MDWORFNGSA-N |
| XLogP | 8.37 |
| TPSA | 87.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|