C12H18O — CID 25146734
(1S,2S,5R,6R,7R)-5-methoxytricyclo[5.4.0.02,6]undec-3-ene (PubChem CID 25146734) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (1S,2S,5R,6R,7R)-5-methoxytricyclo[5.4.0.02,6]undec-3-ene.
| Compound Name | (1S,2S,5R,6R,7R)-5-methoxytricyclo[5.4.0.02,6]undec-3-ene |
|---|---|
| PubChem CID | 25146734 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (1S,2S,5R,6R,7R)-5-methoxytricyclo[5.4.0.02,6]undec-3-ene |
| SMILES | CO[C@@H]1C=C[C@H]2[C@H]3CCCC[C@H]3[C@H]21 |
| InChI | InChI=1S/C12H18O/c1-13-11-7-6-10-8-4-2-3-5-9(8)12(10)11/h6-12H,2-5H2,1H3/t8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | DRDCVWLQNQYJGS-RNWYCLNJSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|