C31H29N5O9 — CID 25146873
(5S,5aS,8aR,9R)-5-[4-[(3-nitroanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 25146873) has the molecular formula C31H29N5O9 and a molecular weight of 615.60 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-[4-[(3-nitroanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-[4-[(3-nitroanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 25146873 |
| Molecular Formula | C31H29N5O9 |
| Molecular Weight | 615.60 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-[4-[(3-nitroanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](n3cc(CNc5cccc([N+](=O)[O-])c5)nn3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C31H29N5O9/c1-40-25-7-16(8-26(41-2)30(25)42-3)27-20-10-23-24(45-15-44-23)11-21(20)29(22-14-43-31(37)28(22)27)35-13-18(33-34-35)12-32-17-5-4-6-19(9-17)36(38)39/h4-11,13,22,27-29,32H,12,14-15H2,1-3H3/t22-,27+,28-,29+/m0/s1 |
| InChIKey | DTONGMYGEYJMOI-ALMBTRMVSA-N |
| XLogP | 4.08 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|