C32H32N4O7 — CID 25146951
(5S,5aS,8aR,9R)-5-[4-[(4-methylanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 25146951) has the molecular formula C32H32N4O7 and a molecular weight of 584.63 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-[4-[(4-methylanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-[4-[(4-methylanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 25146951 |
| Molecular Formula | C32H32N4O7 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-[4-[(4-methylanilino)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](n3cc(CNc5ccc(C)cc5)nn3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C32H32N4O7/c1-17-5-7-19(8-6-17)33-13-20-14-36(35-34-20)30-22-12-25-24(42-16-43-25)11-21(22)28(29-23(30)15-41-32(29)37)18-9-26(38-2)31(40-4)27(10-18)39-3/h5-12,14,23,28-30,33H,13,15-16H2,1-4H3/t23-,28+,29-,30+/m0/s1 |
| InChIKey | DUQIZAFGAKEDAH-VQCLQPKNSA-N |
| XLogP | 4.48 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |